Dear customers, Please note that deliveries to parts of Quetta Pasni & some areas of Balochistan are affected due to restricted logistic movement & deliveries will be delayed in these regions, apologies for the inconvenience it may cause !!
Sub Total
Category: Electronics ,Phones ,Smart Phones
SKU: X300FE-GREEN-12GB-256GB-12gb-256gb
Color:
RAM:
ROM:
Out of Stock
Installment Plan:
yes
Installments:
Select Installment plan
1
Add To Wishlist
Share
Product Description
vivo X300 FE - White
Free Shipping & Returns on this item
Delivery within 8-10 Working days
Money Back Guarantee
More products from seller
| Parameter Type | Parameter name | Contents |
| Basic product information | Brand | vivo |
| Product series | X Series | |
| Marketing name | X300 FE | |
| Network registration name | V2633 | |
| Official marketing name | X300 FE | |
| Phone type | 5G smartphone | |
| Color | Black, White, Green | |
| Launch country/region | Pakistan | |
| Front CCM | Front main camera | |
| Rear CCM | Rear main camera;Rear wide-angle camera;Rear periscope camera | |
| IP (Ingress Protection) Rating | IP68;IP69 | |
| Display | Main display | |
| Appearance | Dimensions (L×W×T) (overall thickness excluding camera)?mm? | 150.83 × 71.76 × 7.99 (Black, Purple, Green), 150.83 × 71.76 × 8.10 (White) |
| Maximum thickness (including camera)?mm? | 11.30 (Black, Purple, Green), 11.40 (White) | |
| Weight of the phone?g? | 191 (Black, Purple, Green), 192 (White) | |
| Remark of the phone Weight | Publicized value | |
| Middle frame material | Aluminum alloy | |
| Battery cover material | Glass | |
| Back cover process | Glass film | |
| Side button material | Aluminum alloy | |
| Aspect ratio | 19.54?9 | |
| Screen-to-body ratio | 94.38% | |
| Earphone port | Type-C (note: only supports Type-C digital earphones) | |
| Camera flash | Rear flash supported | |
| Type of fingerprint sensor | 3D ultrasonic single fingerprint sensor | |
| Material of camera lens | Glass | |
| Camera flash type | Dual rear flash with single color temperature | |
| Fill light | Not supported | |
| CPU/GPU | Material code | 0800443 |
| Material description | IC SoC SM-8845-0-MPSP1526-TR-00-0-AB POP | |
| Marketing name of the platform | Snapdragon® 8 Gen 5 Mobile Platform | |
| Internal name of the platform | SM8845 | |
| CPU core count | Octa-core | |
| CPU architecture | 64 bits | |
| Process node | 3 nm | |
| CPU clock speed | 2 × 3.80 GHz + 6 × 3.32 GHz | |
| CPU model | Oryon CPU | |
| GPU model | Adreno 829 | |
| GPU clock speed | 1225 MHz | |
| Memory | RAM capacity | 12 GB |
| ROM capacity | 256 GB | |
| RAM type | LPDDR5X Ultra | |
| Number of RAM channels | Quad channel | |
| RAM and ROM integrated or not | No | |
| ROM type | UFS 4.1 | |
| Expandable RAM capacity | 12 GB | |
| Memory frequency | 0810253
4800 MHz 0810254 4800 MHz | |
| Read and write speed of ROM (theoretical value) | 0810245
SAMSUNG 256 GB sequential read: 4200 MB/s; sequential write: 3700 MB/s 0810224 KIOXIA 512 GB sequential read: 4250 MB/s; sequential write: 3200 MB/s 0810270 KIOXIA 1 TB sequential read: 4260 MB/s; sequential write: 3800 MB/s | |
| Expandable ROM capacity | Not supported | |
| Main display | Material code | 1211991 |
| Material description | AMOLED 6.31 CPD2443 B901 Black 0.58 mm Schott core GT NT | |
| Display type | Capacitive multi-touch | |
| Display size (right angle) | 6.31? (16.04 cm) | |
| Display resolution | 2640 × 1216 | |
| Display material | AMOLED | |
| Material of cover glass | Schott Xensation core | |
| Material of inner panel | PI | |
| Display technology | On-cell technology | |
| Display pixel density?ppi? | 460 | |
| Display contrast | 8000000:1 | |
| Main display color | 1.07 billion colors | |
| Light-emitting material | U8 | |
| Touch response rate | Normal mode: 130 Hz; Gaming: 300 Hz; Instantaneous response rate: 2000 Hz | |
| Display certification | SGS low blue light certification | |
| PWM | 2160 Hz | |
| Display-related certification of the phone | HDR10+/Netflix HDR | |
| Display brightness (typical value in actual use)?nit? | 800 | |
| Display brightness (HBM value in actual use)?nit? | 1800 | |
| Display brightness (local peak value) | 5000 nits | |
| Display color gamut | P3 wide color gamut supported | |
| Color saturation | P3 wide color gamut supported | |
| Display HDR technology | Supported | |
| Screen refresh rate | 120 Hz, 60 Hz | |
| Front main camera (hardware) | Material code | 2371527 |
| Material description | Single camera, front main camera, CPD2261 F1A5020C-200/C2PA23-A 9.6 × 8.55 × 3.51 A139 Qualcomm + MediaTek | |
| Pixel?MP? | 50 | |
| Focus type | AF | |
| Sensor model | S5KJN1SQ03 | |
| Sensor size | 0.65 cm (1/2.76? ) | |
| Unit pixel size of sensor | 0.64 ?m | |
| Sensor type | CMOS | |
| Aperture | f/2.0 | |
| Optimum macro focus distance | N/A | |
| Motor type | Mid-mounted motor (AF) | |
| Field angle (optical angle) | 92° | |
| OIS (axis) | N/A | |
| Equivalent focal length (mm) | 20 | |
| Type of image stabilizer | N/A | |
| Camera brand | Sunny Optical | |
| Number of lenses | 5P | |
| Phase focus | Yes | |
| Front main camera(hardware part) | Camera mode | Creative,Portrait, Photo, Video, Portrait Video, High Resolution |
| Smart HDR | Supported | |
| Maximum capture resolution | 8160 × 6144 | |
| Video recording resolution | 4K; 1080P | |
| Video recording format | MP4 | |
| Video recording frame rate | 30fps, 60 FPS | |
| Slow motion frame rate | Not supported | |
| Slow motion resolution | Not supported | |
| Video stabilization | EIS | |
| Field angle (after software correction) | 90° | |
| Optimum shooting distance?cm? | 15 cm to infinity | |
| Optical zoom | Not supported | |
| Digital zoom range | 0.8x–2x | |
| Rear main camera(hardware part) | Material code | 2371648 |
| Material description | Single camera, rear main camera, CPD2406 S1A5037C 15.55 × 16 × 4.82 7.699 mm A139 Qualcomm + MediaTek | |
| Pixel?MP? | 50 | |
| Focus type | AF | |
| Sensor model | IMX921-AAJH5-C / LYT702 | |
| Sensor size | 1.02 cm (1/1.56? ) | |
| Unit pixel size of sensor | 1.0 ?m | |
| Sensor type | CMOS | |
| Aperture | f/1.57 | |
| Optimum macro focus distance | 12 cm | |
| Motor type | OIS | |
| Field angle (optical angle) | 84° | |
| OIS (axis) | 4 | |
| Equivalent focal length (mm) | 23 | |
| Type of image stabilizer | OIS | |
| Camera brand | Largan | |
| Number of lenses | 7P | |
| Phase focus | Yes | |
| Rear wide-angle camera(hardware part) | Material code | 2371732 |
| Material description | Single camera, rear wide-angle camera, CPD2528 C58F13 7.6 × 7.6 × 4.275 4.275 mm A166 Qualcomm + MediaTek | |
| Pixel?MP? | 8 | |
| Focus type | FF | |
| Sensor model | OV08F10-GA5H-001B | |
| Sensor size | 0.45 cm (1/4? ) | |
| Unit pixel size of sensor | 1.12 ?m | |
| Sensor type | CMOS | |
| Aperture | f/2.2 | |
| Optimum macro focus distance | N/A | |
| Motor type | N/A | |
| Field angle (optical angle) | 115° | |
| OIS (axis) | N/A | |
| Equivalent focal length (mm) | 15 | |
| Type of image stabilizer | N/A | |
| Camera brand | AAC | |
| Number of lenses | 5P | |
| Phase focus | No | |
| Rear periscope camera(hardware part) | Material code | 2371734 |
| Material description | Single camera, rear periscope telephoto camera, CPD2445 C5PM15 12.6 × 20.03 × 8.15 8.952 mm A166 Qualcomm + MediaTek | |
| Pixel?MP? | 50 | |
| Focus type | AF | |
| Sensor model | IMX882-AJ1H5-C / LYT600 | |
| Sensor size | 0.81 cm (1/1.95? ) | |
| Unit pixel size of sensor | 0.8 ?m | |
| Sensor type | CMOS | |
| Aperture | f/2.65 | |
| Optimum macro focus distance | N/A | |
| Motor type | OIS | |
| Field angle (optical angle) | 33° | |
| OIS (axis) | 2 | |
| Equivalent focal length (mm) | 73 | |
| Type of image stabilizer | OIS | |
| Camera brand | Sunny Optical | |
| Number of lenses | 4P | |
| Phase focus | Yes | |
| Rear main camera(hardware part) | Camera mode | Creative, Snapshot, Landscape & Night, Portrait, Photo, Video, Portrait Video, High Resolution, Pano, Ultra HD Document, Slo-mo, Time-lapse, Stage, Pro, Food, Street Photography |
| Smart HDR | Supported | |
| Maximum capture resolution | 8192 × 6144 | |
| Video recording resolution | 8K; 4K; 1080P | |
| Video recording format | MP4 | |
| Video recording frame rate | 30 FPS, 60 FPS, 120 FPS | |
| Slow motion frame rate | 120 FPS, 240 FPS | |
| Slow motion resolution | 4K, 1080P | |
| Video stabilization | OIS + EIS | |
| Field angle (after software correction) | 84° | |
| Optimum shooting distance?cm? | 12 cm to infinity | |
| Optical zoom | Not supported | |
| Digital zoom | 1x–10x | |
| Laser focus | No | |
| Rear wide-angle camera(hardware part) | Camera mode | Creative, Landscape & Night, Photo, Video, Time-lapse, Pro |
| Smart HDR | Supported | |
| Maximum capture resolution | 3200 × 2400 | |
| Video recording resolution | 1080P | |
| Video recording format | MP4 | |
| Video recording frame rate | 30 FPS | |
| Slow motion frame rate | Not supported | |
| Slow motion resolution | Not supported | |
| Video stabilization | EIS | |
| Field angle (after software correction) | 110° | |
| Optimum shooting distance?cm? | 33 cm to infinity | |
| Optical zoom | Not supported | |
| Digital zoom | 0.6–0.9x | |
| Laser focus | No | |
| Rear periscope camera(hardware part) | Camera mode | Creative, Snapshot, Landscape & Night, Portrait, Photo, Video, Portrait Video, High Resolution, Ultra HD Document, Time-lapse, Stage, Pro, Street Photography |
| Smart HDR | Supported | |
| Maximum capture resolution | 8192 × 6144 | |
| Video recording resolution | 4K; 1080P | |
| Video recording format | MP4 | |
| Video recording frame rate | 30 FPS, 60 FPS | |
| Slow motion frame rate | Not supported | |
| Slow motion resolution | Not supported | |
| Video stabilization | OIS + EIS | |
| Field angle (after software correction) | 33° | |
| Optimum shooting distance?cm? | 65 cm to infinity | |
| Optical zoom | Not supported | |
| Digital zoom | 3x–100x | |
| Laser focus | No | |
| Battery | Battery capacity (typical) | This
product uses a single cell design: Typical capacity: 6500 mAh (3.75V). Typical energy: 24.38 Wh |
| Battery capacity (minimum) | This
product uses a single cell design: Rated capacity: 6350 mAh (3.75V). Rated energy: 23.82 Wh | |
| Battery type | Li-ion battery | |
| Standby duration | Single
SIM standby: 2G: 20.5 days / 3G: 23.7 days / 4G: 23.3 days / 5G: 23.7
days Dual SIM standby: 2G + 3G: 19.3 days / 2G + 4G: 19.5 days / 4G + 4G: 21.2 days | |
| Call duration using 4G VoLTE?h? | 22.4 | |
| Call duration using 5G?h? | 39.1 | |
| Time needed to charge battery from 1% to 100%?min? | Fast charging mode on / Fast charging mode off: 55/68 | |
| Battery weight?g? | 77.2 | |
| Battery model | BB41 | |
| Maximum wired charging power | 90W | |
| Number of battery cells | Single cell | |
| Maximum wireless charging power | 40W | |
| QC protocol supported by wired charging | 9V/1.3A (Qualcomm QC 2.0) | |
| PD protocol supported by wired charging | PD3.0 PPS (5-11V 5A Max) | |
| The charging solution is compatible with fast charging protocols and power | Vivo Flash Charge | Max 90W Fast Charging (11V 8.2A) supported, compatible with 80W (11V 7.3A), 66W (11V 6A), 55W (11V 5A), 44W (11V 4A), 33W (11V 3A), 22.5W (10V 2.25A) |
| UFCS fusion fast charging | Does not support | |
| PD3.0 protocol (PPS fast charging) | 55W (11V 5A) | |
| PD2.0 protocol fast charging | 11.7W (9V 1.3A) | |
| HVDCP 9V fast charging | 11.7W (9V 1.3A) | |
| Standard charging | 10W (5V 2A) | |
| Network | 5G NSA network | n1/n3/n5/n7/n8/n20/n26/n28/n38/n40/n41/n66/n71/n75/n77/n78 |
| 5G ENDC combination | Refer to the latest version of RF Key Information Table. | |
| 5G SA network | n1/n2/n3/n5/n7/n8/n18/n20/n25(1850-1910MHz)/n26/n28/n38/n40/n41/n48/n66/n71/n75/n77/n78 | |
| 5G SRS | NSA: Refer to the latest version of RF Key Information Table. SA: 1T4R: n48/n77/n78; 2T4R: n38/n40/n41; | |
| 4G downlink carrier aggregation (4G+) | Refer to the latest version of RF Key Information Table. | |
| 4G uplink carrier aggregation (4G+) | Refer to the latest version of RF Key Information Table. | |
| 5G network | NR | |
| 4G network | TD-LTE;FDD-LTE | |
| 3G network | WCDMA | |
| 2G network | GSM | |
| 2G GSM frequency band | 850/900/1800/1900MHz | |
| 3G WCDMA frequency band | B1/B2/B4/B5/B6/B8/B19 | |
| 4G TD-LTE frequency band | B34/B38/B39/B40/B41/B42/B43/B48 | |
| 4G FDD-LTE frequency band | B1/B2/B3/B4/B5/B7/B8/B12/B13/B17/B18/B19/B20/B25(1850-1910MHz)/B26/B28/B32/B66/B71 | |
| 5G frequency band | n1/n2/n3/n5/n7/n8/n18/n20/n25(1850-1910MHz)/n26/n28/n38/n40/n41/n48/n66/n71/n75/n77/n78 | |
| LTE MIMO (2×2) | B2;B5;B8;B12;B13;B17;B18;B19;B20;B25;B26;B28;B32;B34;B39;B71 | |
| LTE MIMO (4×4) | B1;B3;B4;B7;B38;B40;B41;B42;B43;B48;B66 | |
| WCDMA diversity | B1;B2;B4;B5;B6;B8;B19 | |
| 4G downlink transmission capacity (CAT) | 19 | |
| 4G uplink transmission capacity (CAT) | 18 | |
| HSPA+ downlink transmission capacity (CAT) | 24 | |
| HSPA+ uplink transmission capacity (CAT) | 6 | |
| EDGE Multislot Class | 33 | |
| GPRS Multislot Class | 33 | |
| 4G speed (uplink) | 200Mbps | |
| 4G speed (downlink) | 1.6Gbps | |
| HSPA+ speed (uplink) | 5.7Mbps | |
| HSPA+ speed (downlink) | 42Mbps | |
| EDGE transmission speed (uplink) | 236.8Kbps | |
| EDGE transmission speed (downlink) | 296Kbps | |
| GPRS transmission speed (uplink) | 85.6Kbps | |
| GPRS transmission speed (downlink) | 107Kbps | |
| Carrier Aggregation (CA) support | Supported | |
| LTE Category | DL Cat. 19 UL Cat. 18 | |
| VoLTE | Supported | |
| ViLTE | Supported | |
| HD Voice | Supported | |
| HD Voice Plus/Crystal Clear | Supported | |
| Max 5G speed under SA/NSA deployment | SA
DL 7.02 Gbps; UL 1.25 Gbps NSA DL 5.08 Gbps; UL 0.725Gbps | |
| VoWiFi | Supported | |
| HPUE (4G) | B41 | |
| HPUE (5G_SA) | n41;n78 | |
| DLNA | Supported | |
| SIM card | SIM card type | 2 nano SIMs |
| SIM1 type | Nano SIM | |
| SIM2 type | Nano SIM | |
| Dual SIM mode | 5G + 5G Dual SIM Dual Standby | |
| Dual SIM network | N + N | |
| Data connection | OTG | Supported |
| Reverse charging | Supported | |
| Maximum output in reverse charging | 1200mA | |
| Type of USB protocol | USB 2.0 | |
| USB port | Type-C | |
| DisplayPort | Not supported | |
| NFC | Reader mode;Supports card simulation mode, which includes HCE payment and NFC-SIM payment* The SIM card used for payment can only be placed in the SIM 1 slot | |
| Bluetooth protocol | 6.0 | |
| Dual-frequency GPS | Supported | |
| Bluetooth audio specification | SBC;AAC;aptX;aptX HD;aptX Adaptive;aptX Lossless;LDAC;LHDC 5.0 | |
| Wireless AP/WLAN hotspot | Supported | |
| EAP SIM | Supported | |
| Bluetooth feature | 1T2R with Antenna switch | |
| WLAN frequency band | 2.4G;5G;6G | |
| WLAN protocol | 802.11b/g/n;802.11a;802.11ac;802.11ax;802.11be | |
| WLAN feature | Wi-Fi Display;2×2 MIMO;MU-MIMO;Wi-Fi 6;Wi-Fi 7 | |
| GPS | L1;L5 | |
| BeiDou | B1C;B1I;B2a | |
| GLONASS | G1 | |
| Galileo | E1;E5a | |
| QZSS | L1;L5 | |
| NavIC | L5 | |
| GNSS feature | AGPS; Cellular network positioning; Wireless local area network positioning | |
| Support listening to broadcast via speaker or not | Not supported | |
| Keyboard type | Virtual keyboard | |
| Data transmission interface | Wi-Fi hotspot; Bluetooth; NFC; OTG interface | |
| Common features | Gesture recognition; Eye protection mode; Notes; Calculator; Local video editing; Recorder; Screen recording | |
| WLAN bandwidth (2.4G) | 40 MHz | |
| WLAN bandwidth (5G) | 160 MHz | |
| Maximum rate of WLAN (2.4G) | 688 Mbps | |
| Maximum rate of WLAN (5G) | 2882 Mbps | |
| Others | / | |
| Wireless & Wired Connection Standards and Protocols | Supported wireless standards and protocols | 802.11a/b/g/n/ac/ax/be, Wi-Fi Direct/Miracast |
| Supported wired standards and protocols | USB-OTG;USB reverse charging | |
| Supported microSD Speed Class | | |
| WLAN hardware parameter | 2.4G (MIMO);5G(MIMO);6G(MIMO) | |
| Sensor | Accelerometer | Supported |
| Ambient light sensor | Supported | |
| Proximity sensor | Supported | |
| E-compass | Supported | |
| Gyroscope | Supported | |
| Fingerprint sensor | 3D ultrasonic single fingerprint sensor | |
| Other sensors | Hall sensor;Infrared blaster;Flicker sensor;X-axis linear motor | |
| Motor | Linear | |
| Basic software configuration | OS version | OriginOS 6 |
| Android version | Android 16 | |
| vivoCloud | Supported | |
| SMS storage capacity | Unlimited | |
| Contacts storage capacity | Unlimited | |
| Call recording | Supported | |
| Group text message limit | Follow google | |
| Default input method | Gboard | |
| Typing method | Pinyin; English; Handwriting; Stroke;Voice typing;Glide typing | |
| Mic noise reduction | Dual-mic noise reduction | |
| Multimedia | Music player | AAC?WAV?M4A?MP3?MIDI?OGG?APE?FLAC |
| Audio playback format | AAC?WAV?MP3?MIDI?VORBIS?APE?FLAC | |
| Audio recording | Supported | |
| Video playback format | MP4;3GP;AVI;FLV;MKV;WEBM;TS;ASF | |
| Other special features | Smart motion | Supported |
| Smart on/off display | Supported | |
| Smart call | Supported | |
| Two-way call recording | Supported | |
| Super screenshot | Supported | |
| WeChat key | Supported | |
| Face Access | Supported | |
| Phone_Assistant (Domestic Sales)/Intelligent Call Assistant (Export Sales) | Supported | |
| Little V Help (Domestic Sales)/AI Subtitles (Export Sales) | Supported | |
| Accessories | Accessories info (Industrial design) | Phone; Eject tool; Warranty card; Quick start guide |
| Accessories info (Structure) | Phone case | |
| Accessories info (Electronics) | Charger;USB cable | |
| Charger model | V9082L0A1-EU | |
| Charger input frequency | 50 Hz / 60 Hz | |
| Charger input voltage | 100-120V~? 200-240V~ | |
| Charger output voltage | 5.0V or 9.0V or 11.0V | |
| Charger output current | INPUT? 100-120V~ OUTPUT ? 5.0V/3.0A-9.0V/2.0A-11.0V/4.0A Max INPUT ? 200-240V~ OUTPUT ? 5.0V/3.0A-9.0V/2.0A-11.0V/8.2A Max | |
| Maximum support current of data cable | 8.5A | |
| Weight of the phone (including product box + accessories) (g) | 617.2±5% | |
| Overall weight (including phone) (g) | 6715.9±5% | |
| Country of origin | China, Pakistan | |
| Warranty | Warranty policy | 1 YEAR |
